C11H5Cl2IN4 — CID 114030805
8-chloro-3-(5-chloro-2-iodophenyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 114030805) has the molecular formula C11H5Cl2IN4 and a molecular weight of 391.00 g/mol. Its IUPAC name is 8-chloro-3-(5-chloro-2-iodophenyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-(5-chloro-2-iodophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 114030805 |
| Molecular Formula | C11H5Cl2IN4 |
| Molecular Weight | 391.00 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 8-chloro-3-(5-chloro-2-iodophenyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1ccc(I)c(-c2nnc3c(Cl)nccn23)c1 |
| InChI | InChI=1S/C11H5Cl2IN4/c12-6-1-2-8(14)7(5-6)10-16-17-11-9(13)15-3-4-18(10)11/h1-5H |
| InChIKey | RJTLNMUWONFDPK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|