C8H6Cl2N2O2 — CID 167720138
5-chloroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride (PubChem CID 167720138) has the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. Its IUPAC name is 5-chloroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride.
| Compound Name | 5-chloroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 167720138 |
| Molecular Formula | C8H6Cl2N2O2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 5-chloroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc2nccn2c1Cl |
| InChI | InChI=1S/C8H5ClN2O2.ClH/c9-7-5(8(12)13)1-2-6-10-3-4-11(6)7;/h1-4H,(H,12,13);1H |
| InChIKey | HXZYIVKJNLXWOZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|