C6H10N2O2 — CID 124707036
4-(hydroxymethyl)-1,3-dimethylimidazol-2-one (PubChem CID 124707036) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,3-dimethylimidazol-2-one.
| Compound Name | 4-(hydroxymethyl)-1,3-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 124707036 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 4-(hydroxymethyl)-1,3-dimethylimidazol-2-one |
| SMILES | Cn1cc(CO)n(C)c1=O |
| InChI | InChI=1S/C6H10N2O2/c1-7-3-5(4-9)8(2)6(7)10/h3,9H,4H2,1-2H3 |
| InChIKey | OIVPIJPVELOFJR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |