C7H14N2O — CID 67521278
(1,2,3-trimethyl-2H-imidazol-4-yl)methanol (PubChem CID 67521278) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (1,2,3-trimethyl-2H-imidazol-4-yl)methanol.
| Compound Name | (1,2,3-trimethyl-2H-imidazol-4-yl)methanol |
|---|---|
| PubChem CID | 67521278 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (1,2,3-trimethyl-2H-imidazol-4-yl)methanol |
| SMILES | CC1N(C)C=C(CO)N1C |
| InChI | InChI=1S/C7H14N2O/c1-6-8(2)4-7(5-10)9(6)3/h4,6,10H,5H2,1-3H3 |
| InChIKey | RVJWDFJQLXKOQZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |