About (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol
(2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol (PubChem CID 86341547) has the molecular formula C5H11N3O
and a molecular weight of 129.16 g/mol. Its IUPAC name is (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol.
Analyze (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol?
The IUPAC name of (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol (CID 86341547) is (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol.
What is the SMILES notation for (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol?
The canonical SMILES for (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol is CN1C(CO)=CNC1N.
What is the InChIKey of (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol?
The InChIKey is DYQANNIXFBNKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O/c1-8-4(3-9)2-7-5(8)6/h2,5,7,9H,3,6H2,1H3.
What are the key properties of (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol?
(2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol has a molecular weight of 129.16 g/mol, XLogP of -1.40, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-methyl-1,2-dihydroimidazol-4-yl)methanol is sourced from PubChem (CID 86341547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).