C9H18N2O2 — CID 18673623
[3-(3-ethoxypropyl)-1,2-dihydroimidazol-5-yl]methanol (PubChem CID 18673623) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is [3-(3-ethoxypropyl)-1,2-dihydroimidazol-5-yl]methanol.
| Compound Name | [3-(3-ethoxypropyl)-1,2-dihydroimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 18673623 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [3-(3-ethoxypropyl)-1,2-dihydroimidazol-5-yl]methanol |
| SMILES | CCOCCCN1C=C(CO)NC1 |
| InChI | InChI=1S/C9H18N2O2/c1-2-13-5-3-4-11-6-9(7-12)10-8-11/h6,10,12H,2-5,7-8H2,1H3 |
| InChIKey | WXSSUFUTHQETKY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|