About [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol
[3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol (PubChem CID 129095818) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol.
Analyze [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol?
The IUPAC name of [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol (CID 129095818) is [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol.
What is the SMILES notation for [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol?
The canonical SMILES for [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol is CC(C)CN1CNC=C1CO.
What is the InChIKey of [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol?
The InChIKey is LZDMHVHQRAZTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(2)4-10-6-9-3-8(10)5-11/h3,7,9,11H,4-6H2,1-2H3.
What are the key properties of [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol?
[3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol has a molecular weight of 156.23 g/mol, XLogP of 0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methylpropyl)-1,2-dihydroimidazol-4-yl]methanol is sourced from PubChem (CID 129095818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).