C8H14N2OS — CID 40505221
3-butyl-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 40505221) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 3-butyl-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-butyl-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 40505221 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-butyl-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | CCCCn1c(CO)c[nH]c1=S |
| InChI | InChI=1S/C8H14N2OS/c1-2-3-4-10-7(6-11)5-9-8(10)12/h5,11H,2-4,6H2,1H3,(H,9,12) |
| InChIKey | OEOOVXDZPZDGDG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|