About (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol
(2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol (PubChem CID 86340537) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol.
Analyze (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol?
The IUPAC name of (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol (CID 86340537) is (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol.
What is the SMILES notation for (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol?
The canonical SMILES for (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol is CC1NC=C(CO)N1.
What is the InChIKey of (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol?
The InChIKey is UOQQRLGNJLCJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4-6-2-5(3-8)7-4/h2,4,6-8H,3H2,1H3.
What are the key properties of (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol?
(2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol has a molecular weight of 114.15 g/mol, XLogP of -0.64, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydro-1H-imidazol-4-yl)methanol is sourced from PubChem (CID 86340537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).