C6H12N2O — CID 86341091
2-(4-methyl-1,2-dihydroimidazol-3-yl)ethanol (PubChem CID 86341091) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-(4-methyl-1,2-dihydroimidazol-3-yl)ethanol.
| Compound Name | 2-(4-methyl-1,2-dihydroimidazol-3-yl)ethanol |
|---|---|
| PubChem CID | 86341091 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-(4-methyl-1,2-dihydroimidazol-3-yl)ethanol |
| SMILES | CC1=CNCN1CCO |
| InChI | InChI=1S/C6H12N2O/c1-6-4-7-5-8(6)2-3-9/h4,7,9H,2-3,5H2,1H3 |
| InChIKey | JFOLBWFRNWDMRZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |