C6H11NO — CID 124709598
(2R,3R)-2-ethenyloxolan-3-amine (PubChem CID 124709598) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (2R,3R)-2-ethenyloxolan-3-amine.
| Compound Name | (2R,3R)-2-ethenyloxolan-3-amine |
|---|---|
| PubChem CID | 124709598 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (2R,3R)-2-ethenyloxolan-3-amine |
| SMILES | C=C[C@H]1OCC[C@H]1N |
| InChI | InChI=1S/C6H11NO/c1-2-6-5(7)3-4-8-6/h2,5-6H,1,3-4,7H2/t5-,6-/m1/s1 |
| InChIKey | MNJYWTHQNUBTIC-PHDIDXHHSA-N |
| XLogP | 0.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|