C27H23FN2O5 — CID 124710985
ethyl 4-[(3S,3aR,6aR)-3-(4-fluorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 124710985) has the molecular formula C27H23FN2O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is ethyl 4-[(3S,3aR,6aR)-3-(4-fluorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 4-[(3S,3aR,6aR)-3-(4-fluorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 124710985 |
| Molecular Formula | C27H23FN2O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | ethyl 4-[(3S,3aR,6aR)-3-(4-fluorophenyl)-2-(2-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H](c4ccc(F)cc4)N(c4ccccc4C)O[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H23FN2O5/c1-3-34-27(33)18-10-14-20(15-11-18)29-25(31)22-23(17-8-12-19(28)13-9-17)30(35-24(22)26(29)32)21-7-5-4-6-16(21)2/h4-15,22-24H,3H2,1-2H3/t22-,23-,24-/m1/s1 |
| InChIKey | BWFLKAYZLZOWIC-WXFUMESZSA-N |
| XLogP | 4.36 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|