C28H24F3N5O — CID 124711113
(1S)-N'-(2,5-diphenyl-[1,3]oxazolo[4,5-d]pyrimidin-7-yl)-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 124711113) has the molecular formula C28H24F3N5O and a molecular weight of 503.53 g/mol. Its IUPAC name is (1S)-N'-(2,5-diphenyl-[1,3]oxazolo[4,5-d]pyrimidin-7-yl)-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | (1S)-N'-(2,5-diphenyl-[1,3]oxazolo[4,5-d]pyrimidin-7-yl)-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 124711113 |
| Molecular Formula | C28H24F3N5O |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (1S)-N'-(2,5-diphenyl-[1,3]oxazolo[4,5-d]pyrimidin-7-yl)-N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | CN(C)[C@H](CNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H24F3N5O/c1-36(2)22(20-14-9-15-21(16-20)28(29,30)31)17-32-25-23-26(34-24(33-25)18-10-5-3-6-11-18)35-27(37-23)19-12-7-4-8-13-19/h3-16,22H,17H2,1-2H3,(H,32,33,34)/t22-/m1/s1 |
| InChIKey | GFOXWFGNFKAEBK-JOCHJYFZSA-N |
| XLogP | 6.69 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |