C22H26F3N3O2 — CID 166201585
N'-[2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-N-[(2,6-dimethylphenyl)methyl]oxamide (PubChem CID 166201585) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-N-[(2,6-dimethylphenyl)methyl]oxamide.
| Compound Name | N'-[2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-N-[(2,6-dimethylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 166201585 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N'-[2-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]ethyl]-N-[(2,6-dimethylphenyl)methyl]oxamide |
| SMILES | Cc1cccc(C)c1CNC(=O)C(=O)NCC(c1cccc(C(F)(F)F)c1)N(C)C |
| InChI | InChI=1S/C22H26F3N3O2/c1-14-7-5-8-15(2)18(14)12-26-20(29)21(30)27-13-19(28(3)4)16-9-6-10-17(11-16)22(23,24)25/h5-11,19H,12-13H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | BUWNQUVZYVPWHJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|