C32H27Br2NO6 — CID 124713398
[2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate (PubChem CID 124713398) has the molecular formula C32H27Br2NO6 and a molecular weight of 681.38 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 124713398 |
| Molecular Formula | C32H27Br2NO6 |
| Molecular Weight | 681.38 g/mol |
| Exact Mass | 679.02 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2S)-2-[(15R,19R)-1,8-dibromo-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-3-methylbutanoate |
| SMILES | COc1ccc(C(=O)COC(=O)[C@H](C(C)C)N2C(=O)[C@H]3[C@H](C2=O)C2(Br)c4ccccc4C3(Br)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H27Br2NO6/c1-17(2)27(30(39)41-16-24(36)18-12-14-19(40-3)15-13-18)35-28(37)25-26(29(35)38)32(34)21-9-5-4-8-20(21)31(25,33)22-10-6-7-11-23(22)32/h4-15,17,25-27H,16H2,1-3H3/t25-,26-,27+,31?,32?/m1/s1 |
| InChIKey | FDZWUIKINWYMFI-PPFAFTSKSA-N |
| XLogP | 5.35 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|