C17H25NO3 — CID 124717535
(1R,2R,3R,4R)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 124717535) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124717535 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (1R,2R,3R,4R)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@H]1[C@H](C(=O)O)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H25NO3/c1-9-4-3-5-13(10(9)2)18-16(19)14-11-6-7-12(8-11)15(14)17(20)21/h6-7,9-15H,3-5,8H2,1-2H3,(H,18,19)(H,20,21)/t9-,10-,11+,12+,13+,14-,15-/m1/s1 |
| InChIKey | XAGZJDIKHFHOLH-UBRSESRLSA-N |
| XLogP | 2.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|