C32H26N4O4S2 — CID 124722728
(2S,6R,7S,9R,13R,14R)-4,11-bis(4-methylphenyl)-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 124722728) has the molecular formula C32H26N4O4S2 and a molecular weight of 594.72 g/mol. Its IUPAC name is (2S,6R,7S,9R,13R,14R)-4,11-bis(4-methylphenyl)-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | (2S,6R,7S,9R,13R,14R)-4,11-bis(4-methylphenyl)-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 124722728 |
| Molecular Formula | C32H26N4O4S2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | (2S,6R,7S,9R,13R,14R)-4,11-bis(4-methylphenyl)-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)N2[C@@H](c4cccs4)[C@@H]4C(=O)N(c5ccc(C)cc5)C(=O)[C@@H]4N2[C@@H]3c2cccs2)cc1 |
| InChI | InChI=1S/C32H26N4O4S2/c1-17-7-11-19(12-8-17)33-29(37)23-25(21-5-3-15-41-21)36-28-24(26(22-6-4-16-42-22)35(36)27(23)31(33)39)30(38)34(32(28)40)20-13-9-18(2)10-14-20/h3-16,23-28H,1-2H3/t23-,24-,25-,26+,27+,28-/m0/s1 |
| InChIKey | SOEGIFSLPAGFKR-ACWZPJHASA-N |
| XLogP | 4.87 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|