C30H22N4O4S2 — CID 124754344
(2R,6R,7R,9R,13R,14S)-4,11-diphenyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 124754344) has the molecular formula C30H22N4O4S2 and a molecular weight of 566.66 g/mol. Its IUPAC name is (2R,6R,7R,9R,13R,14S)-4,11-diphenyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | (2R,6R,7R,9R,13R,14S)-4,11-diphenyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 124754344 |
| Molecular Formula | C30H22N4O4S2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | (2R,6R,7R,9R,13R,14S)-4,11-diphenyl-7,14-dithiophen-2-yl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1)N1[C@H](c3cccs3)[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3N1[C@H]2c1cccs1 |
| InChI | InChI=1S/C30H22N4O4S2/c35-27-21-23(19-13-7-15-39-19)34-26-22(28(36)32(30(26)38)18-11-5-2-6-12-18)24(20-14-8-16-40-20)33(34)25(21)29(37)31(27)17-9-3-1-4-10-17/h1-16,21-26H/t21-,22-,23-,24+,25+,26+/m0/s1 |
| InChIKey | NTGNSAKLDDFUOA-LZNKSJHBSA-N |
| XLogP | 4.25 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|