C17H20F3N3O2 — CID 124723682
2-[(2S,4aR,8aR)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 124723682) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[(2S,4aR,8aR)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2S,4aR,8aR)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 124723682 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[(2S,4aR,8aR)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[C@@H]1N[C@@H]2CCCC[C@H]2NC1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O2/c18-17(19,20)10-5-1-2-6-11(10)22-15(24)9-14-16(25)23-13-8-4-3-7-12(13)21-14/h1-2,5-6,12-14,21H,3-4,7-9H2,(H,22,24)(H,23,25)/t12-,13-,14+/m1/s1 |
| InChIKey | XBTXGKRBJMABOG-MCIONIFRSA-N |
| XLogP | 2.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |