C13H15F3N3O2+ — CID 4067396
2-(3-oxopiperazin-1-ium-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 4067396) has the molecular formula C13H15F3N3O2+ and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-(3-oxopiperazin-1-ium-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-oxopiperazin-1-ium-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4067396 |
| Molecular Formula | C13H15F3N3O2+ |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(3-oxopiperazin-1-ium-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CC1[NH2+]CCNC1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O2/c14-13(15,16)8-3-1-2-4-9(8)19-11(20)7-10-12(21)18-6-5-17-10/h1-4,10,17H,5-7H2,(H,18,21)(H,19,20)/p+1 |
| InChIKey | PUWNNWLQSPWQAP-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |