C22H25N3O2S — CID 41168895
2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 41168895) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 41168895 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(2S,4aR,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(C[C@@H]1N[C@H]2CCCC[C@H]2NC1=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2S/c26-21(14-19-22(27)25-17-11-5-4-10-16(17)23-19)24-18-12-6-7-13-20(18)28-15-8-2-1-3-9-15/h1-3,6-9,12-13,16-17,19,23H,4-5,10-11,14H2,(H,24,26)(H,25,27)/t16-,17+,19-/m0/s1 |
| InChIKey | RZMQOSLRWYACBH-SCTDSRPQSA-N |
| XLogP | 3.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |