C16H19Cl2N3O2 — CID 40975642
2-[(2R,4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 40975642) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-[(2R,4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[(2R,4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 40975642 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2R,4aS,8aS)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | O=C(C[C@H]1N[C@H]2CCCC[C@@H]2NC1=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-9-4-3-7-12(15(9)18)20-14(22)8-13-16(23)21-11-6-2-1-5-10(11)19-13/h3-4,7,10-11,13,19H,1-2,5-6,8H2,(H,20,22)(H,21,23)/t10-,11-,13+/m0/s1 |
| InChIKey | RHTZWMPSUOXWQY-GMXVVIOVSA-N |
| XLogP | 2.72 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |