C20H26N2O5 — CID 124724492
(1S,2R,3S,4S)-3-[[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124724492) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-3-[[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124724492 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (1S,2R,3S,4S)-3-[[[(2R)-2-(3,5-dimethylphenoxy)propanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1cc(C)cc(O[C@H](C)C(=O)NNC(=O)[C@H]2[C@H]3CC[C@@H](C3)[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C20H26N2O5/c1-10-6-11(2)8-15(7-10)27-12(3)18(23)21-22-19(24)16-13-4-5-14(9-13)17(16)20(25)26/h6-8,12-14,16-17H,4-5,9H2,1-3H3,(H,21,23)(H,22,24)(H,25,26)/t12-,13+,14+,16+,17-/m1/s1 |
| InChIKey | ZGVGHJUYTKSFHT-UAHISNFZSA-N |
| XLogP | 1.97 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|