C19H22Cl2N2O5 — CID 27526599
(1S,2S,3R,4R)-3-[[[(2S)-2-(2,5-dichlorophenoxy)butanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 27526599) has the molecular formula C19H22Cl2N2O5 and a molecular weight of 429.30 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[[(2S)-2-(2,5-dichlorophenoxy)butanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[[(2S)-2-(2,5-dichlorophenoxy)butanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 27526599 |
| Molecular Formula | C19H22Cl2N2O5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[[(2S)-2-(2,5-dichlorophenoxy)butanoyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC[C@H](Oc1cc(Cl)ccc1Cl)C(=O)NNC(=O)[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C19H22Cl2N2O5/c1-2-13(28-14-8-11(20)5-6-12(14)21)17(24)22-23-18(25)15-9-3-4-10(7-9)16(15)19(26)27/h5-6,8-10,13,15-16H,2-4,7H2,1H3,(H,22,24)(H,23,25)(H,26,27)/t9-,10+,13+,15-,16+/m1/s1 |
| InChIKey | BBIXIACUVQGTEF-BDUBRWIHSA-N |
| XLogP | 3.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|