C14H16Cl2N2O5 — CID 4252186
4-[2-[2-(2,5-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoic acid (PubChem CID 4252186) has the molecular formula C14H16Cl2N2O5 and a molecular weight of 363.20 g/mol. Its IUPAC name is 4-[2-[2-(2,5-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-(2,5-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4252186 |
| Molecular Formula | C14H16Cl2N2O5 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-[2-[2-(2,5-dichlorophenoxy)butanoyl]hydrazinyl]-4-oxobutanoic acid |
| SMILES | CCC(Oc1cc(Cl)ccc1Cl)C(=O)NNC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H16Cl2N2O5/c1-2-10(23-11-7-8(15)3-4-9(11)16)14(22)18-17-12(19)5-6-13(20)21/h3-4,7,10H,2,5-6H2,1H3,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | KCGYDAZAUJNPDH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|