C18H18Cl2N2O4 — CID 51417522
(2S)-N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(2,5-dichlorophenoxy)butanamide (PubChem CID 51417522) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is (2S)-N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(2,5-dichlorophenoxy)butanamide.
| Compound Name | (2S)-N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(2,5-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 51417522 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (2S)-N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(2,5-dichlorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1cc(Cl)ccc1Cl)C(=O)NN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-2-14(26-15-9-10(19)7-8-13(15)20)16(23)21-22-17(24)11-5-3-4-6-12(11)18(22)25/h3-4,7-9,11-12,14H,2,5-6H2,1H3,(H,21,23)/t11-,12+,14-/m0/s1 |
| InChIKey | OOEKXRMALPTNQH-SCRDCRAPSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|