C18H16N4O — CID 124725170
1H-indol-3-yl-[(1S,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 124725170) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 1H-indol-3-yl-[(1S,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | 1H-indol-3-yl-[(1S,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 124725170 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1H-indol-3-yl-[(1S,9S)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | O=C(c1c[nH]c2ccccc12)N1[C@H]2CC[C@H]1c1cncnc1C2 |
| InChI | InChI=1S/C18H16N4O/c23-18(13-9-20-15-4-2-1-3-12(13)15)22-11-5-6-17(22)14-8-19-10-21-16(14)7-11/h1-4,8-11,17,20H,5-7H2/t11-,17-/m0/s1 |
| InChIKey | DBBHLKPLRIIKHA-GTNSWQLSSA-N |
| XLogP | 2.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |