C14H24N2O — CID 124728717
(1S,2R,5S,6S)-N-pentyl-3-azatricyclo[4.2.1.02,5]nonane-3-carboxamide (PubChem CID 124728717) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,2R,5S,6S)-N-pentyl-3-azatricyclo[4.2.1.02,5]nonane-3-carboxamide.
| Compound Name | (1S,2R,5S,6S)-N-pentyl-3-azatricyclo[4.2.1.02,5]nonane-3-carboxamide |
|---|---|
| PubChem CID | 124728717 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (1S,2R,5S,6S)-N-pentyl-3-azatricyclo[4.2.1.02,5]nonane-3-carboxamide |
| SMILES | CCCCCNC(=O)N1C[C@@H]2[C@H]3CC[C@@H](C3)[C@H]21 |
| InChI | InChI=1S/C14H24N2O/c1-2-3-4-7-15-14(17)16-9-12-10-5-6-11(8-10)13(12)16/h10-13H,2-9H2,1H3,(H,15,17)/t10-,11-,12+,13+/m0/s1 |
| InChIKey | FDMWFLRDHPDGNF-WUHRBBMRSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|