C13H18F3N3O3 — CID 124728860
(6R,7aR)-6-methoxy-2-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 124728860) has the molecular formula C13H18F3N3O3 and a molecular weight of 321.30 g/mol. Its IUPAC name is (6R,7aR)-6-methoxy-2-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aR)-6-methoxy-2-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 124728860 |
| Molecular Formula | C13H18F3N3O3 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (6R,7aR)-6-methoxy-2-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CO[C@@H]1C[C@@H]2C(=O)N([C@H]3CCN(CC(F)(F)F)C3)C(=O)N2C1 |
| InChI | InChI=1S/C13H18F3N3O3/c1-22-9-4-10-11(20)19(12(21)18(10)6-9)8-2-3-17(5-8)7-13(14,15)16/h8-10H,2-7H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | FLXXOIPSQSIMJT-IVZWLZJFSA-N |
| XLogP | 0.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|