C18H21N3O4 — CID 124729104
(6R,7aR)-6-methoxy-2-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 124729104) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is (6R,7aR)-6-methoxy-2-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aR)-6-methoxy-2-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 124729104 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (6R,7aR)-6-methoxy-2-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CO[C@@H]1C[C@@H]2C(=O)N([C@H]3C[C@H](C)N(c4ccccc4)C3=O)C(=O)N2C1 |
| InChI | InChI=1S/C18H21N3O4/c1-11-8-15(17(23)20(11)12-6-4-3-5-7-12)21-16(22)14-9-13(25-2)10-19(14)18(21)24/h3-7,11,13-15H,8-10H2,1-2H3/t11-,13+,14+,15-/m0/s1 |
| InChIKey | FRCLDYYMARXZQZ-MYPMTAMASA-N |
| XLogP | 1.23 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|