C17H22N2O3 — CID 100637780
(6R,7aS)-6-methoxy-2-[(1R)-2-methyl-1-phenylpropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 100637780) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (6R,7aS)-6-methoxy-2-[(1R)-2-methyl-1-phenylpropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (6R,7aS)-6-methoxy-2-[(1R)-2-methyl-1-phenylpropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 100637780 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (6R,7aS)-6-methoxy-2-[(1R)-2-methyl-1-phenylpropyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CO[C@@H]1C[C@H]2C(=O)N(C(c3ccccc3)C(C)C)C(=O)N2C1 |
| InChI | InChI=1S/C17H22N2O3/c1-11(2)15(12-7-5-4-6-8-12)19-16(20)14-9-13(22-3)10-18(14)17(19)21/h4-8,11,13-15H,9-10H2,1-3H3/t13-,14+,15?/m1/s1 |
| InChIKey | HTEAYYPAXDRYNJ-GNXJLENFSA-N |
| XLogP | 2.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|