C14H18N3O2+ — CID 7682058
(8aS)-2-[(1R)-1-phenylethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazin-7-ium-1,3-dione (PubChem CID 7682058) has the molecular formula C14H18N3O2+ and a molecular weight of 260.32 g/mol. Its IUPAC name is (8aS)-2-[(1R)-1-phenylethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazin-7-ium-1,3-dione.
| Compound Name | (8aS)-2-[(1R)-1-phenylethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazin-7-ium-1,3-dione |
|---|---|
| PubChem CID | 7682058 |
| Molecular Formula | C14H18N3O2+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (8aS)-2-[(1R)-1-phenylethyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazin-7-ium-1,3-dione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@@H]2C[NH2+]CCN2C1=O |
| InChI | InChI=1S/C14H17N3O2/c1-10(11-5-3-2-4-6-11)17-13(18)12-9-15-7-8-16(12)14(17)19/h2-6,10,12,15H,7-9H2,1H3/p+1/t10-,12+/m1/s1 |
| InChIKey | KFVNJDKKTCMRDK-PWSUYJOCSA-O |
| XLogP | -0.04 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|