C18H20N3O5- — CID 7682068
4-[(8aS)-1,3-dioxo-2-[(1R)-1-phenylethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-4-oxobutanoate (PubChem CID 7682068) has the molecular formula C18H20N3O5- and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-[(8aS)-1,3-dioxo-2-[(1R)-1-phenylethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-4-oxobutanoate.
| Compound Name | 4-[(8aS)-1,3-dioxo-2-[(1R)-1-phenylethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7682068 |
| Molecular Formula | C18H20N3O5- |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-[(8aS)-1,3-dioxo-2-[(1R)-1-phenylethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-4-oxobutanoate |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@@H]2CN(C(=O)CCC(=O)[O-])CCN2C1=O |
| InChI | InChI=1S/C18H21N3O5/c1-12(13-5-3-2-4-6-13)21-17(25)14-11-19(9-10-20(14)18(21)26)15(22)7-8-16(23)24/h2-6,12,14H,7-11H2,1H3,(H,23,24)/p-1/t12-,14+/m1/s1 |
| InChIKey | WKPXGOXJAWYGCT-OCCSQVGLSA-M |
| XLogP | -0.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|