C11H12FN3O4 — CID 124729769
(3S)-1-(5-fluoro-2-nitrophenyl)-3-hydroxypyrrolidine-3-carboxamide (PubChem CID 124729769) has the molecular formula C11H12FN3O4 and a molecular weight of 269.23 g/mol. Its IUPAC name is (3S)-1-(5-fluoro-2-nitrophenyl)-3-hydroxypyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(5-fluoro-2-nitrophenyl)-3-hydroxypyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124729769 |
| Molecular Formula | C11H12FN3O4 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3S)-1-(5-fluoro-2-nitrophenyl)-3-hydroxypyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(O)CCN(c2cc(F)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H12FN3O4/c12-7-1-2-8(15(18)19)9(5-7)14-4-3-11(17,6-14)10(13)16/h1-2,5,17H,3-4,6H2,(H2,13,16)/t11-/m0/s1 |
| InChIKey | GQHNMECYQLBSQE-NSHDSACASA-N |
| XLogP | 0.16 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|