C17H33N3O2S — CID 124731142
(1S,7R)-7-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-1,4-thiazepane-4-carboxamide (PubChem CID 124731142) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is (1S,7R)-7-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-1,4-thiazepane-4-carboxamide.
| Compound Name | (1S,7R)-7-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 124731142 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (1S,7R)-7-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-oxo-1,4-thiazepane-4-carboxamide |
| SMILES | CC1CCN(CCCCNC(=O)N2CC[C@@H](C)[S@@](=O)CC2)CC1 |
| InChI | InChI=1S/C17H33N3O2S/c1-15-5-10-19(11-6-15)9-4-3-8-18-17(21)20-12-7-16(2)23(22)14-13-20/h15-16H,3-14H2,1-2H3,(H,18,21)/t16-,23+/m1/s1 |
| InChIKey | IQBAQFJHKOWQIN-MWTRTKDXSA-N |
| XLogP | 2.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|