C16H31N3O2 — CID 87002663
2,2-dimethyl-N-[3-(4-methylpiperidin-1-yl)propyl]morpholine-4-carboxamide (PubChem CID 87002663) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-(4-methylpiperidin-1-yl)propyl]morpholine-4-carboxamide.
| Compound Name | 2,2-dimethyl-N-[3-(4-methylpiperidin-1-yl)propyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 87002663 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2,2-dimethyl-N-[3-(4-methylpiperidin-1-yl)propyl]morpholine-4-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)N2CCOC(C)(C)C2)CC1 |
| InChI | InChI=1S/C16H31N3O2/c1-14-5-9-18(10-6-14)8-4-7-17-15(20)19-11-12-21-16(2,3)13-19/h14H,4-13H2,1-3H3,(H,17,20) |
| InChIKey | XOBWGRXAJNEBRB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|