C19H25N3O — CID 124732707
N-[(1R,2R)-2-benzylcyclopentyl]-3-(1H-imidazol-5-yl)-N-methylpropanamide (PubChem CID 124732707) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(1R,2R)-2-benzylcyclopentyl]-3-(1H-imidazol-5-yl)-N-methylpropanamide.
| Compound Name | N-[(1R,2R)-2-benzylcyclopentyl]-3-(1H-imidazol-5-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 124732707 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(1R,2R)-2-benzylcyclopentyl]-3-(1H-imidazol-5-yl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCc1cnc[nH]1)[C@@H]1CCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O/c1-22(19(23)11-10-17-13-20-14-21-17)18-9-5-8-16(18)12-15-6-3-2-4-7-15/h2-4,6-7,13-14,16,18H,5,8-12H2,1H3,(H,20,21)/t16-,18-/m1/s1 |
| InChIKey | JWFOWKSFQUNBLU-SJLPKXTDSA-N |
| XLogP | 3.21 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |