C15H16N4O3S — CID 124733555
(2R)-1-phenyl-N-pyrazin-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 124733555) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is (2R)-1-phenyl-N-pyrazin-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-phenyl-N-pyrazin-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 124733555 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (2R)-1-phenyl-N-pyrazin-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cnccn1)[C@H]1CCCN1c1ccccc1 |
| InChI | InChI=1S/C15H16N4O3S/c20-15(18-23(21,22)14-11-16-8-9-17-14)13-7-4-10-19(13)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,13H,4,7,10H2,(H,18,20)/t13-/m1/s1 |
| InChIKey | LHJIAJKOYRTDEI-CYBMUJFWSA-N |
| XLogP | 0.95 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |