C21H29NO2 — CID 124736634
[(3S,3aR,6aR)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[(2R,4R)-2-ethyloxan-4-yl]methanone (PubChem CID 124736634) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is [(3S,3aR,6aR)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[(2R,4R)-2-ethyloxan-4-yl]methanone.
| Compound Name | [(3S,3aR,6aR)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[(2R,4R)-2-ethyloxan-4-yl]methanone |
|---|---|
| PubChem CID | 124736634 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | [(3S,3aR,6aR)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[(2R,4R)-2-ethyloxan-4-yl]methanone |
| SMILES | CC[C@@H]1C[C@H](C(=O)N2C[C@H](c3ccccc3)[C@H]3CCC[C@H]32)CCO1 |
| InChI | InChI=1S/C21H29NO2/c1-2-17-13-16(11-12-24-17)21(23)22-14-19(15-7-4-3-5-8-15)18-9-6-10-20(18)22/h3-5,7-8,16-20H,2,6,9-14H2,1H3/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | PBEZGNOLFGAORV-LASHMREHSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |