C20H28N2O2 — CID 143724846
[(4S,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-morpholin-3-yl]methanone (PubChem CID 143724846) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is [(4S,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-morpholin-3-yl]methanone.
| Compound Name | [(4S,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-morpholin-3-yl]methanone |
|---|---|
| PubChem CID | 143724846 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(4S,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[(3R)-morpholin-3-yl]methanone |
| SMILES | O=C([C@H]1COCCN1)N1CC[C@H](c2ccccc2)C2CCCC[C@H]21 |
| InChI | InChI=1S/C20H28N2O2/c23-20(18-14-24-13-11-21-18)22-12-10-16(15-6-2-1-3-7-15)17-8-4-5-9-19(17)22/h1-3,6-7,16-19,21H,4-5,8-14H2/t16-,17?,18-,19-/m1/s1 |
| InChIKey | YSVRBHJEJZRLPP-CEBOQPEMSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |