C21H26N2O2 — CID 71085864
[(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone (PubChem CID 71085864) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 71085864 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CC[C@H](c3ccccc3)[C@H]3CCCC[C@H]32)c(C)o1 |
| InChI | InChI=1S/C21H26N2O2/c1-14-20(22-15(2)25-14)21(24)23-13-12-17(16-8-4-3-5-9-16)18-10-6-7-11-19(18)23/h3-5,8-9,17-19H,6-7,10-13H2,1-2H3/t17-,18-,19-/m1/s1 |
| InChIKey | LQJPXKSHELZWOI-GUDVDZBRSA-N |
| XLogP | 4.48 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |