C21H23N3OS — CID 71085990
[(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-imidazo[2,1-b][1,3]thiazol-6-ylmethanone (PubChem CID 71085990) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-imidazo[2,1-b][1,3]thiazol-6-ylmethanone.
| Compound Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-imidazo[2,1-b][1,3]thiazol-6-ylmethanone |
|---|---|
| PubChem CID | 71085990 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-imidazo[2,1-b][1,3]thiazol-6-ylmethanone |
| SMILES | O=C(c1cn2ccsc2n1)N1CC[C@H](c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H23N3OS/c25-20(18-14-23-12-13-26-21(23)22-18)24-11-10-16(15-6-2-1-3-7-15)17-8-4-5-9-19(17)24/h1-3,6-7,12-14,16-17,19H,4-5,8-11H2/t16-,17-,19-/m1/s1 |
| InChIKey | UCUIUKWTUPPUGX-ZHALLVOQSA-N |
| XLogP | 4.58 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |