C26H25F3N2OS — CID 71086118
[(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanone (PubChem CID 71086118) has the molecular formula C26H25F3N2OS and a molecular weight of 470.56 g/mol. Its IUPAC name is [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanone.
| Compound Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 71086118 |
| Molecular Formula | C26H25F3N2OS |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [(4S,4aR,8aR)-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(-c2ccc(C(F)(F)F)cc2)n1)N1CC[C@H](c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C26H25F3N2OS/c27-26(28,29)19-12-10-18(11-13-19)24-30-22(16-33-24)25(32)31-15-14-20(17-6-2-1-3-7-17)21-8-4-5-9-23(21)31/h1-3,6-7,10-13,16,20-21,23H,4-5,8-9,14-15H2/t20-,21-,23-/m1/s1 |
| InChIKey | JMMFDTAWJXCRPP-MQSCRBSSSA-N |
| XLogP | 7.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |