C11H20N2O2 — CID 96998627
[(2R)-2-methylpiperidin-1-yl]-[(3S)-morpholin-3-yl]methanone (PubChem CID 96998627) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(2R)-2-methylpiperidin-1-yl]-[(3S)-morpholin-3-yl]methanone.
| Compound Name | [(2R)-2-methylpiperidin-1-yl]-[(3S)-morpholin-3-yl]methanone |
|---|---|
| PubChem CID | 96998627 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [(2R)-2-methylpiperidin-1-yl]-[(3S)-morpholin-3-yl]methanone |
| SMILES | C[C@@H]1CCCCN1C(=O)[C@@H]1COCCN1 |
| InChI | InChI=1S/C11H20N2O2/c1-9-4-2-3-6-13(9)11(14)10-8-15-7-5-12-10/h9-10,12H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | HJGAXSWBBOVRSV-ZJUUUORDSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |