C24H24N2O2 — CID 154837875
4-methyl-7-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-1H-quinolin-2-one (PubChem CID 154837875) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-methyl-7-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-1H-quinolin-2-one.
| Compound Name | 4-methyl-7-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154837875 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-methyl-7-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2cc(C(=O)N3CC(c4ccccc4)C4CCCC43)ccc12 |
| InChI | InChI=1S/C24H24N2O2/c1-15-12-23(27)25-21-13-17(10-11-18(15)21)24(28)26-14-20(16-6-3-2-4-7-16)19-8-5-9-22(19)26/h2-4,6-7,10-13,19-20,22H,5,8-9,14H2,1H3,(H,25,27) |
| InChIKey | CYLAUBLKLIUSNK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |