C25H21NO2 — CID 10316895
6,7-diphenyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid (PubChem CID 10316895) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 6,7-diphenyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid.
| Compound Name | 6,7-diphenyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 10316895 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 6,7-diphenyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c3c([nH]c2c1)CC(c1ccccc1)C(c1ccccc1)C3 |
| InChI | InChI=1S/C25H21NO2/c27-25(28)18-11-12-19-22-14-20(16-7-3-1-4-8-16)21(17-9-5-2-6-10-17)15-24(22)26-23(19)13-18/h1-13,20-21,26H,14-15H2,(H,27,28) |
| InChIKey | JCHYRVMLMVMQAN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|