6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid

C15H17NO2 — CID 10332026

IUPAC6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid
SMILESCC1Cc2[nH]c3cc(C(=O)O)ccc3c2CC1C
InChIInChI=1S/C15H17NO2/c1-8-5-12-11-4-3-10(15(17)18)7-14(11)16-13(12)6-9(8)2/h3-4,7-9,16H,5-6H2,1-2H3,(H,17,18)
InChIKeyVONLIXLMCMEQIK-UHFFFAOYSA-N
MW243.31 g/mol
LogP3.24
Rot. Bonds1

About 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid

6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid (PubChem CID 10332026) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid.

Molecular Properties

Compound Name6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid
PubChem CID10332026
Molecular FormulaC15H17NO2
Molecular Weight243.31 g/mol
Exact Mass243.13
IUPAC Name6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid
SMILESCC1Cc2[nH]c3cc(C(=O)O)ccc3c2CC1C
InChIInChI=1S/C15H17NO2/c1-8-5-12-11-4-3-10(15(17)18)7-14(11)16-13(12)6-9(8)2/h3-4,7-9,16H,5-6H2,1-2H3,(H,17,18)
InChIKeyVONLIXLMCMEQIK-UHFFFAOYSA-N
XLogP3.24
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.31
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid?
The IUPAC name of 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid (CID 10332026) is 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid.
What is the SMILES notation for 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid?
The canonical SMILES for 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid is CC1Cc2[nH]c3cc(C(=O)O)ccc3c2CC1C.
What is the InChIKey of 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid?
The InChIKey is VONLIXLMCMEQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c1-8-5-12-11-4-3-10(15(17)18)7-14(11)16-13(12)6-9(8)2/h3-4,7-9,16H,5-6H2,1-2H3,(H,17,18).
What are the key properties of 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid?
6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid has a molecular weight of 243.31 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-6,7,8,9-tetrahydro-5H-carbazole-2-carboxylic acid is sourced from PubChem (CID 10332026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).