C16H17N2O2+ — CID 123187302
3-methyl-2-propan-2-yl-9H-pyrido[3,4-b]indol-2-ium-7-carboxylic acid (PubChem CID 123187302) has the molecular formula C16H17N2O2+ and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-methyl-2-propan-2-yl-9H-pyrido[3,4-b]indol-2-ium-7-carboxylic acid.
| Compound Name | 3-methyl-2-propan-2-yl-9H-pyrido[3,4-b]indol-2-ium-7-carboxylic acid |
|---|---|
| PubChem CID | 123187302 |
| Molecular Formula | C16H17N2O2+ |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-methyl-2-propan-2-yl-9H-pyrido[3,4-b]indol-2-ium-7-carboxylic acid |
| SMILES | Cc1cc2c(c[n+]1C(C)C)[nH]c1cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C16H16N2O2/c1-9(2)18-8-15-13(6-10(18)3)12-5-4-11(16(19)20)7-14(12)17-15/h4-9H,1-3H3,(H,19,20)/p+1 |
| InChIKey | GSPYWURZZHBAHR-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|