C17H12NO6S- — CID 54713776
7-carboxy-3-(4-methylphenyl)sulfonyl-2-oxo-1H-quinolin-4-olate (PubChem CID 54713776) has the molecular formula C17H12NO6S- and a molecular weight of 358.35 g/mol. Its IUPAC name is 7-carboxy-3-(4-methylphenyl)sulfonyl-2-oxo-1H-quinolin-4-olate.
| Compound Name | 7-carboxy-3-(4-methylphenyl)sulfonyl-2-oxo-1H-quinolin-4-olate |
|---|---|
| PubChem CID | 54713776 |
| Molecular Formula | C17H12NO6S- |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 7-carboxy-3-(4-methylphenyl)sulfonyl-2-oxo-1H-quinolin-4-olate |
| SMILES | Cc1ccc(S(=O)(=O)c2c([O-])c3ccc(C(=O)O)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H13NO6S/c1-9-2-5-11(6-3-9)25(23,24)15-14(19)12-7-4-10(17(21)22)8-13(12)18-16(15)20/h2-8H,1H3,(H,21,22)(H2,18,19,20)/p-1 |
| InChIKey | OXSWMKYTXNYKRA-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |