C23H33NO2 — CID 19384522
6,6-dimethyl-5-octyl-5,7,8,9-tetrahydrocarbazole-2-carboxylic acid (PubChem CID 19384522) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 6,6-dimethyl-5-octyl-5,7,8,9-tetrahydrocarbazole-2-carboxylic acid.
| Compound Name | 6,6-dimethyl-5-octyl-5,7,8,9-tetrahydrocarbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 19384522 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 6,6-dimethyl-5-octyl-5,7,8,9-tetrahydrocarbazole-2-carboxylic acid |
| SMILES | CCCCCCCCC1c2c([nH]c3cc(C(=O)O)ccc23)CCC1(C)C |
| InChI | InChI=1S/C23H33NO2/c1-4-5-6-7-8-9-10-18-21-17-12-11-16(22(25)26)15-20(17)24-19(21)13-14-23(18,2)3/h11-12,15,18,24H,4-10,13-14H2,1-3H3,(H,25,26) |
| InChIKey | CEGVNPLBWYETQJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|